C13H29N3 — CID 163933005
(Z,5S)-5-ethyl-N',6-dimethyl-N-(methylaminomethyl)hept-3-ene-1,7-diamine (PubChem CID 163933005) has the molecular formula C13H29N3 and a molecular weight of 227.40 g/mol. Its IUPAC name is (Z,5S)-5-ethyl-N',6-dimethyl-N-(methylaminomethyl)hept-3-ene-1,7-diamine.
| Compound Name | (Z,5S)-5-ethyl-N',6-dimethyl-N-(methylaminomethyl)hept-3-ene-1,7-diamine |
|---|---|
| PubChem CID | 163933005 |
| Molecular Formula | C13H29N3 |
| Molecular Weight | 227.40 g/mol |
| Exact Mass | 227.24 |
| IUPAC Name | (Z,5S)-5-ethyl-N',6-dimethyl-N-(methylaminomethyl)hept-3-ene-1,7-diamine |
| SMILES | CC[C@@H](/C=C\CCNCNC)C(C)CNC |
| InChI | InChI=1S/C13H29N3/c1-5-13(12(2)10-14-3)8-6-7-9-16-11-15-4/h6,8,12-16H,5,7,9-11H2,1-4H3/b8-6-/t12?,13-/m0/s1 |
| InChIKey | RKHNBDPZJDARLN-LAHMFIBTSA-N |
| XLogP | 1.58 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.40 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|