C31H41BrN2O5Si — CID 163933839
(6aS)-3-(5-bromopentoxy)-2-methoxy-8-(4-methylphenyl)-5-(2-trimethylsilylethoxymethyl)-6a,7-dihydropyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione (PubChem CID 163933839) has the molecular formula C31H41BrN2O5Si and a molecular weight of 629.67 g/mol. Its IUPAC name is (6aS)-3-(5-bromopentoxy)-2-methoxy-8-(4-methylphenyl)-5-(2-trimethylsilylethoxymethyl)-6a,7-dihydropyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione.
| Compound Name | (6aS)-3-(5-bromopentoxy)-2-methoxy-8-(4-methylphenyl)-5-(2-trimethylsilylethoxymethyl)-6a,7-dihydropyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione |
|---|---|
| PubChem CID | 163933839 |
| Molecular Formula | C31H41BrN2O5Si |
| Molecular Weight | 629.67 g/mol |
| Exact Mass | 628.20 |
| IUPAC Name | (6aS)-3-(5-bromopentoxy)-2-methoxy-8-(4-methylphenyl)-5-(2-trimethylsilylethoxymethyl)-6a,7-dihydropyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione |
| SMILES | COc1cc2c(cc1OCCCCCBr)N(COCC[Si](C)(C)C)C(=O)[C@@H]1CC(c3ccc(C)cc3)=CN1C2=O |
| InChI | InChI=1S/C31H41BrN2O5Si/c1-22-9-11-23(12-10-22)24-17-27-31(36)34(21-38-15-16-40(3,4)5)26-19-29(39-14-8-6-7-13-32)28(37-2)18-25(26)30(35)33(27)20-24/h9-12,18-20,27H,6-8,13-17,21H2,1-5H3/t27-/m0/s1 |
| InChIKey | JUUPWUKPDFDXTN-MHZLTWQESA-N |
| XLogP | 6.86 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.67 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|