C28H37N3O4Si — CID 71099781
3-(2-aminoethyl)-2-methoxy-8-(4-methylphenyl)-5-(2-trimethylsilylethoxymethyl)-6a,7-dihydropyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione (PubChem CID 71099781) has the molecular formula C28H37N3O4Si and a molecular weight of 507.71 g/mol. Its IUPAC name is 3-(2-aminoethyl)-2-methoxy-8-(4-methylphenyl)-5-(2-trimethylsilylethoxymethyl)-6a,7-dihydropyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione.
| Compound Name | 3-(2-aminoethyl)-2-methoxy-8-(4-methylphenyl)-5-(2-trimethylsilylethoxymethyl)-6a,7-dihydropyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione |
|---|---|
| PubChem CID | 71099781 |
| Molecular Formula | C28H37N3O4Si |
| Molecular Weight | 507.71 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | 3-(2-aminoethyl)-2-methoxy-8-(4-methylphenyl)-5-(2-trimethylsilylethoxymethyl)-6a,7-dihydropyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione |
| SMILES | COc1cc2c(cc1CCN)N(COCC[Si](C)(C)C)C(=O)C1CC(c3ccc(C)cc3)=CN1C2=O |
| InChI | InChI=1S/C28H37N3O4Si/c1-19-6-8-20(9-7-19)22-15-25-28(33)31(18-35-12-13-36(3,4)5)24-14-21(10-11-29)26(34-2)16-23(24)27(32)30(25)17-22/h6-9,14,16-17,25H,10-13,15,18,29H2,1-5H3 |
| InChIKey | HOJARNKSSFDRMP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.71 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|