C30H34N2O5Si — CID 157348649
(6aS)-2-hydroxy-8-(6-methoxynaphthalen-2-yl)-3-methyl-5-(2-trimethylsilylethoxymethyl)-6a,7-dihydropyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione (PubChem CID 157348649) has the molecular formula C30H34N2O5Si and a molecular weight of 530.70 g/mol. Its IUPAC name is (6aS)-2-hydroxy-8-(6-methoxynaphthalen-2-yl)-3-methyl-5-(2-trimethylsilylethoxymethyl)-6a,7-dihydropyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione.
| Compound Name | (6aS)-2-hydroxy-8-(6-methoxynaphthalen-2-yl)-3-methyl-5-(2-trimethylsilylethoxymethyl)-6a,7-dihydropyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione |
|---|---|
| PubChem CID | 157348649 |
| Molecular Formula | C30H34N2O5Si |
| Molecular Weight | 530.70 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | (6aS)-2-hydroxy-8-(6-methoxynaphthalen-2-yl)-3-methyl-5-(2-trimethylsilylethoxymethyl)-6a,7-dihydropyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione |
| SMILES | COc1ccc2cc(C3=CN4C(=O)c5cc(O)c(C)cc5N(COCC[Si](C)(C)C)C(=O)[C@@H]4C3)ccc2c1 |
| InChI | InChI=1S/C30H34N2O5Si/c1-19-12-26-25(16-28(19)33)29(34)31-17-23(21-6-7-22-14-24(36-2)9-8-20(22)13-21)15-27(31)30(35)32(26)18-37-10-11-38(3,4)5/h6-9,12-14,16-17,27,33H,10-11,15,18H2,1-5H3/t27-/m0/s1 |
| InChIKey | IYZPIERVCLRDAC-MHZLTWQESA-N |
| XLogP | 5.78 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.70 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|