C20H25F3N2O7SSi — CID 172769640
[(6aS)-2-methoxy-6,11-dioxo-5-(2-trimethylsilylethoxymethyl)-6a,7-dihydropyrrolo[2,1-c][1,4]benzodiazepin-8-yl] trifluoromethanesulfonate (PubChem CID 172769640) has the molecular formula C20H25F3N2O7SSi and a molecular weight of 522.57 g/mol. Its IUPAC name is [(6aS)-2-methoxy-6,11-dioxo-5-(2-trimethylsilylethoxymethyl)-6a,7-dihydropyrrolo[2,1-c][1,4]benzodiazepin-8-yl] trifluoromethanesulfonate.
| Compound Name | [(6aS)-2-methoxy-6,11-dioxo-5-(2-trimethylsilylethoxymethyl)-6a,7-dihydropyrrolo[2,1-c][1,4]benzodiazepin-8-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 172769640 |
| Molecular Formula | C20H25F3N2O7SSi |
| Molecular Weight | 522.57 g/mol |
| Exact Mass | 522.11 |
| IUPAC Name | [(6aS)-2-methoxy-6,11-dioxo-5-(2-trimethylsilylethoxymethyl)-6a,7-dihydropyrrolo[2,1-c][1,4]benzodiazepin-8-yl] trifluoromethanesulfonate |
| SMILES | COc1ccc2c(c1)C(=O)N1C=C(OS(=O)(=O)C(F)(F)F)C[C@H]1C(=O)N2COCC[Si](C)(C)C |
| InChI | InChI=1S/C20H25F3N2O7SSi/c1-30-13-5-6-16-15(9-13)18(26)24-11-14(32-33(28,29)20(21,22)23)10-17(24)19(27)25(16)12-31-7-8-34(2,3)4/h5-6,9,11,17H,7-8,10,12H2,1-4H3/t17-/m0/s1 |
| InChIKey | MTWYACQFAXZDQW-KRWDZBQOSA-N |
| XLogP | 3.28 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.57 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|