C22H22N2O2 — CID 163938598
1-N,3-N-dimethyl-1-N,3-N-diphenylcyclohexa-1,5-diene-1,3-dicarboxamide (PubChem CID 163938598) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is 1-N,3-N-dimethyl-1-N,3-N-diphenylcyclohexa-1,5-diene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-dimethyl-1-N,3-N-diphenylcyclohexa-1,5-diene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 163938598 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 1-N,3-N-dimethyl-1-N,3-N-diphenylcyclohexa-1,5-diene-1,3-dicarboxamide |
| SMILES | CN(C(=O)C1=CC(C(=O)N(C)c2ccccc2)CC=C1)c1ccccc1 |
| InChI | InChI=1S/C22H22N2O2/c1-23(19-12-5-3-6-13-19)21(25)17-10-9-11-18(16-17)22(26)24(2)20-14-7-4-8-15-20/h3-10,12-16,18H,11H2,1-2H3 |
| InChIKey | ROZXBTGSHJIFQO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|