About O-[2-(methylidene-λ3-iodanyl)-2-(propan-2-ylamino)ethyl]hydroxylamine
O-[2-(methylidene-λ3-iodanyl)-2-(propan-2-ylamino)ethyl]hydroxylamine (PubChem CID 163939305) has the molecular formula C6H15IN2O
and a molecular weight of 258.10 g/mol. Its IUPAC name is O-[2-(methylidene-λ3-iodanyl)-2-(propan-2-ylamino)ethyl]hydroxylamine.
Molecular Properties
| Compound Name | O-[2-(methylidene-λ3-iodanyl)-2-(propan-2-ylamino)ethyl]hydroxylamine |
| PubChem CID | 163939305 |
| Molecular Formula | C6H15IN2O |
| Molecular Weight | 258.10 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | O-[2-(methylidene-λ3-iodanyl)-2-(propan-2-ylamino)ethyl]hydroxylamine |
| SMILES | C=IC(CON)NC(C)C |
| InChI | InChI=1S/C6H15IN2O/c1-5(2)9-6(7-3)4-10-8/h5-6,9H,3-4,8H2,1-2H3 |
| InChIKey | RPPJBNPVBQRTAS-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.10 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze O-[2-(methylidene-λ3-iodanyl)-2-(propan-2-ylamino)ethyl]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[2-(methylidene-λ3-iodanyl)-2-(propan-2-ylamino)ethyl]hydroxylamine?
The IUPAC name of O-[2-(methylidene-λ3-iodanyl)-2-(propan-2-ylamino)ethyl]hydroxylamine (CID 163939305) is O-[2-(methylidene-λ3-iodanyl)-2-(propan-2-ylamino)ethyl]hydroxylamine.
What is the SMILES notation for O-[2-(methylidene-λ3-iodanyl)-2-(propan-2-ylamino)ethyl]hydroxylamine?
The canonical SMILES for O-[2-(methylidene-λ3-iodanyl)-2-(propan-2-ylamino)ethyl]hydroxylamine is C=IC(CON)NC(C)C.
What is the InChIKey of O-[2-(methylidene-λ3-iodanyl)-2-(propan-2-ylamino)ethyl]hydroxylamine?
The InChIKey is RPPJBNPVBQRTAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15IN2O/c1-5(2)9-6(7-3)4-10-8/h5-6,9H,3-4,8H2,1-2H3.
What are the key properties of O-[2-(methylidene-λ3-iodanyl)-2-(propan-2-ylamino)ethyl]hydroxylamine?
O-[2-(methylidene-λ3-iodanyl)-2-(propan-2-ylamino)ethyl]hydroxylamine has a molecular weight of 258.10 g/mol, XLogP of 0.60, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-[2-(methylidene-λ3-iodanyl)-2-(propan-2-ylamino)ethyl]hydroxylamine is sourced from PubChem (CID 163939305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).