C8H19NO2 — CID 134479894
1,3-dimethoxy-N-propan-2-ylpropan-2-amine (PubChem CID 134479894) has the molecular formula C8H19NO2 and a molecular weight of 161.25 g/mol. Its IUPAC name is 1,3-dimethoxy-N-propan-2-ylpropan-2-amine.
| Compound Name | 1,3-dimethoxy-N-propan-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 134479894 |
| Molecular Formula | C8H19NO2 |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.14 |
| IUPAC Name | 1,3-dimethoxy-N-propan-2-ylpropan-2-amine |
| SMILES | COCC(COC)NC(C)C |
| InChI | InChI=1S/C8H19NO2/c1-7(2)9-8(5-10-3)6-11-4/h7-9H,5-6H2,1-4H3 |
| InChIKey | BPYCSLVGLQIXPT-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |