C28H48N4O6 — CID 163941679
tert-butyl N-[(2S)-1-[(2S)-2-[[1-cyclopropyl-4-(methylamino)-3,4-dioxobutan-2-yl]carbamoyl]-3,4,4-trimethylpiperidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate (PubChem CID 163941679) has the molecular formula C28H48N4O6 and a molecular weight of 536.71 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[(2S)-2-[[1-cyclopropyl-4-(methylamino)-3,4-dioxobutan-2-yl]carbamoyl]-3,4,4-trimethylpiperidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[(2S)-2-[[1-cyclopropyl-4-(methylamino)-3,4-dioxobutan-2-yl]carbamoyl]-3,4,4-trimethylpiperidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 163941679 |
| Molecular Formula | C28H48N4O6 |
| Molecular Weight | 536.71 g/mol |
| Exact Mass | 536.36 |
| IUPAC Name | tert-butyl N-[(2S)-1-[(2S)-2-[[1-cyclopropyl-4-(methylamino)-3,4-dioxobutan-2-yl]carbamoyl]-3,4,4-trimethylpiperidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
| SMILES | CNC(=O)C(=O)C(CC1CC1)NC(=O)[C@@H]1C(C)C(C)(C)CCN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C28H48N4O6/c1-16-19(22(34)30-18(15-17-11-12-17)20(33)23(35)29-10)32(14-13-28(16,8)9)24(36)21(26(2,3)4)31-25(37)38-27(5,6)7/h16-19,21H,11-15H2,1-10H3,(H,29,35)(H,30,34)(H,31,37)/t16?,18?,19-,21+/m0/s1 |
| InChIKey | RRNIKNDPTNITIF-LDVNLBKXSA-N |
| XLogP | 2.79 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.71 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|