C14H24IN — CID 163943692
(3R,3'S)-2'-ethyl-3'-iodo-3-methylspiro[bicyclo[3.2.0]heptane-2,4'-cyclopentane]-1'-amine (PubChem CID 163943692) has the molecular formula C14H24IN and a molecular weight of 333.26 g/mol. Its IUPAC name is (3R,3'S)-2'-ethyl-3'-iodo-3-methylspiro[bicyclo[3.2.0]heptane-2,4'-cyclopentane]-1'-amine.
| Compound Name | (3R,3'S)-2'-ethyl-3'-iodo-3-methylspiro[bicyclo[3.2.0]heptane-2,4'-cyclopentane]-1'-amine |
|---|---|
| PubChem CID | 163943692 |
| Molecular Formula | C14H24IN |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | (3R,3'S)-2'-ethyl-3'-iodo-3-methylspiro[bicyclo[3.2.0]heptane-2,4'-cyclopentane]-1'-amine |
| SMILES | CCC1C(N)CC2(C3CCC3C[C@H]2C)[C@H]1I |
| InChI | InChI=1S/C14H24IN/c1-3-10-12(16)7-14(13(10)15)8(2)6-9-4-5-11(9)14/h8-13H,3-7,16H2,1-2H3/t8-,9?,10?,11?,12?,13+,14?/m1/s1 |
| InChIKey | RTGBYKKJNBCIDZ-ZOSDIUFLSA-N |
| XLogP | 3.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|