C10H16S — CID 134438038
7-methyltricyclo[3.2.2.01,4]nonane-2-thiol (PubChem CID 134438038) has the molecular formula C10H16S and a molecular weight of 168.30 g/mol. Its IUPAC name is 7-methyltricyclo[3.2.2.01,4]nonane-2-thiol.
| Compound Name | 7-methyltricyclo[3.2.2.01,4]nonane-2-thiol |
|---|---|
| PubChem CID | 134438038 |
| Molecular Formula | C10H16S |
| Molecular Weight | 168.30 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 7-methyltricyclo[3.2.2.01,4]nonane-2-thiol |
| SMILES | CC1CC2CCC13C(S)CC23 |
| InChI | InChI=1S/C10H16S/c1-6-4-7-2-3-10(6)8(7)5-9(10)11/h6-9,11H,2-5H2,1H3 |
| InChIKey | CHYMQUNYOLTDEO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|