C9H8INO — CID 163949491
N-(3-iodo-6-methylidenecyclohexa-2,4-dien-1-ylidene)acetamide (PubChem CID 163949491) has the molecular formula C9H8INO and a molecular weight of 273.07 g/mol. Its IUPAC name is N-(3-iodo-6-methylidenecyclohexa-2,4-dien-1-ylidene)acetamide.
| Compound Name | N-(3-iodo-6-methylidenecyclohexa-2,4-dien-1-ylidene)acetamide |
|---|---|
| PubChem CID | 163949491 |
| Molecular Formula | C9H8INO |
| Molecular Weight | 273.07 g/mol |
| Exact Mass | 272.97 |
| IUPAC Name | N-(3-iodo-6-methylidenecyclohexa-2,4-dien-1-ylidene)acetamide |
| SMILES | C=C1C=CC(I)=C/C1=N\C(C)=O |
| InChI | InChI=1S/C9H8INO/c1-6-3-4-8(10)5-9(6)11-7(2)12/h3-5H,1H2,2H3/b11-9+ |
| InChIKey | RYBMRDUJRNIXGF-PKNBQFBNSA-N |
| XLogP | 2.42 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.07 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|