C15H19F2NO — CID 163950109
(3Z,5E)-5-(difluoromethyl)-N-[(3E)-4-methylhexa-1,3,5-trien-3-yl]hepta-3,5-dienamide (PubChem CID 163950109) has the molecular formula C15H19F2NO and a molecular weight of 267.32 g/mol. Its IUPAC name is (3Z,5E)-5-(difluoromethyl)-N-[(3E)-4-methylhexa-1,3,5-trien-3-yl]hepta-3,5-dienamide.
| Compound Name | (3Z,5E)-5-(difluoromethyl)-N-[(3E)-4-methylhexa-1,3,5-trien-3-yl]hepta-3,5-dienamide |
|---|---|
| PubChem CID | 163950109 |
| Molecular Formula | C15H19F2NO |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | (3Z,5E)-5-(difluoromethyl)-N-[(3E)-4-methylhexa-1,3,5-trien-3-yl]hepta-3,5-dienamide |
| SMILES | C=C/C(C)=C(\C=C)NC(=O)C/C=C\C(=C/C)C(F)F |
| InChI | InChI=1S/C15H19F2NO/c1-5-11(4)13(7-3)18-14(19)10-8-9-12(6-2)15(16)17/h5-9,15H,1,3,10H2,2,4H3,(H,18,19)/b9-8-,12-6+,13-11+ |
| InChIKey | RYPAJZBIMWAODZ-YNYHJPQKSA-N |
| XLogP | 3.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|