About 2-(1λ3-iodiran-1-yliodanuidylmethyl)-3-methoxyaniline
2-(1λ3-iodiran-1-yliodanuidylmethyl)-3-methoxyaniline (PubChem CID 163951770) has the molecular formula C10H14I2NO-
and a molecular weight of 418.04 g/mol. Its IUPAC name is 2-(1λ3-iodiran-1-yliodanuidylmethyl)-3-methoxyaniline.
Molecular Properties
| Compound Name | 2-(1λ3-iodiran-1-yliodanuidylmethyl)-3-methoxyaniline |
| PubChem CID | 163951770 |
| Molecular Formula | C10H14I2NO- |
| Molecular Weight | 418.04 g/mol |
| Exact Mass | 417.92 |
| IUPAC Name | 2-(1λ3-iodiran-1-yliodanuidylmethyl)-3-methoxyaniline |
| SMILES | COc1cccc(N)c1C[I-]I1CC1 |
| InChI | InChI=1S/C10H14I2NO/c1-14-10-4-2-3-9(13)8(10)7-11-12-5-6-12/h2-4H,5-7,13H2,1H3/q-1 |
| InChIKey | HSXDOFADYKJWLY-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.04 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(1λ3-iodiran-1-yliodanuidylmethyl)-3-methoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1λ3-iodiran-1-yliodanuidylmethyl)-3-methoxyaniline?
The IUPAC name of 2-(1λ3-iodiran-1-yliodanuidylmethyl)-3-methoxyaniline (CID 163951770) is 2-(1λ3-iodiran-1-yliodanuidylmethyl)-3-methoxyaniline.
What is the SMILES notation for 2-(1λ3-iodiran-1-yliodanuidylmethyl)-3-methoxyaniline?
The canonical SMILES for 2-(1λ3-iodiran-1-yliodanuidylmethyl)-3-methoxyaniline is COc1cccc(N)c1C[I-]I1CC1.
What is the InChIKey of 2-(1λ3-iodiran-1-yliodanuidylmethyl)-3-methoxyaniline?
The InChIKey is HSXDOFADYKJWLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14I2NO/c1-14-10-4-2-3-9(13)8(10)7-11-12-5-6-12/h2-4H,5-7,13H2,1H3/q-1.
What are the key properties of 2-(1λ3-iodiran-1-yliodanuidylmethyl)-3-methoxyaniline?
2-(1λ3-iodiran-1-yliodanuidylmethyl)-3-methoxyaniline has a molecular weight of 418.04 g/mol, XLogP of -0.70, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1λ3-iodiran-1-yliodanuidylmethyl)-3-methoxyaniline is sourced from PubChem (CID 163951770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).