C30H24N2O6S — CID 163952972
[(Z)-[2-[4-(4-benzoylphenyl)sulfanylcyclohexa-1,3-dien-1-yl]-1-(2-methyl-3-nitrophenyl)-2-oxoethylidene]amino] acetate (PubChem CID 163952972) has the molecular formula C30H24N2O6S and a molecular weight of 540.60 g/mol. Its IUPAC name is [(Z)-[2-[4-(4-benzoylphenyl)sulfanylcyclohexa-1,3-dien-1-yl]-1-(2-methyl-3-nitrophenyl)-2-oxoethylidene]amino] acetate.
| Compound Name | [(Z)-[2-[4-(4-benzoylphenyl)sulfanylcyclohexa-1,3-dien-1-yl]-1-(2-methyl-3-nitrophenyl)-2-oxoethylidene]amino] acetate |
|---|---|
| PubChem CID | 163952972 |
| Molecular Formula | C30H24N2O6S |
| Molecular Weight | 540.60 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | [(Z)-[2-[4-(4-benzoylphenyl)sulfanylcyclohexa-1,3-dien-1-yl]-1-(2-methyl-3-nitrophenyl)-2-oxoethylidene]amino] acetate |
| SMILES | CC(=O)O/N=C(\C(=O)C1=CC=C(Sc2ccc(C(=O)c3ccccc3)cc2)CC1)c1cccc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C30H24N2O6S/c1-19-26(9-6-10-27(19)32(36)37)28(31-38-20(2)33)30(35)23-13-17-25(18-14-23)39-24-15-11-22(12-16-24)29(34)21-7-4-3-5-8-21/h3-13,15-17H,14,18H2,1-2H3/b31-28- |
| InChIKey | SAXWXZAQJARXEO-PNOGMODKSA-N |
| XLogP | 6.37 |
| TPSA | 115.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.60 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|