About N-hydroxybutan-2-amine oxide;manganese
N-hydroxybutan-2-amine oxide;manganese (PubChem CID 163957457) has the molecular formula C4H11MnNO2
and a molecular weight of 160.07 g/mol. Its IUPAC name is N-hydroxybutan-2-amine oxide;manganese.
Molecular Properties
| Compound Name | N-hydroxybutan-2-amine oxide;manganese |
| PubChem CID | 163957457 |
| Molecular Formula | C4H11MnNO2 |
| Molecular Weight | 160.07 g/mol |
| Exact Mass | 160.02 |
| IUPAC Name | N-hydroxybutan-2-amine oxide;manganese |
| SMILES | CCC(C)[NH+]([O-])O.[Mn] |
| InChI | InChI=1S/C4H11NO2.Mn/c1-3-4(2)5(6)7;/h4-6H,3H2,1-2H3; |
| InChIKey | IKEPILMATDCUFX-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 47.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.07 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxybutan-2-amine oxide;manganese with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxybutan-2-amine oxide;manganese?
The IUPAC name of N-hydroxybutan-2-amine oxide;manganese (CID 163957457) is N-hydroxybutan-2-amine oxide;manganese.
What is the SMILES notation for N-hydroxybutan-2-amine oxide;manganese?
The canonical SMILES for N-hydroxybutan-2-amine oxide;manganese is CCC(C)[NH+]([O-])O.[Mn].
What is the InChIKey of N-hydroxybutan-2-amine oxide;manganese?
The InChIKey is IKEPILMATDCUFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11NO2.Mn/c1-3-4(2)5(6)7;/h4-6H,3H2,1-2H3;.
What are the key properties of N-hydroxybutan-2-amine oxide;manganese?
N-hydroxybutan-2-amine oxide;manganese has a molecular weight of 160.07 g/mol, XLogP of -0.45, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxybutan-2-amine oxide;manganese is sourced from PubChem (CID 163957457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).