C20H25NO7 — CID 163969867
2-hydroxy-3-[2-[2-[2-[2-hydroxy-3-(hydroxymethyl)phenoxy]ethylamino]ethoxy]ethoxy]benzaldehyde (PubChem CID 163969867) has the molecular formula C20H25NO7 and a molecular weight of 391.42 g/mol. Its IUPAC name is 2-hydroxy-3-[2-[2-[2-[2-hydroxy-3-(hydroxymethyl)phenoxy]ethylamino]ethoxy]ethoxy]benzaldehyde.
| Compound Name | 2-hydroxy-3-[2-[2-[2-[2-hydroxy-3-(hydroxymethyl)phenoxy]ethylamino]ethoxy]ethoxy]benzaldehyde |
|---|---|
| PubChem CID | 163969867 |
| Molecular Formula | C20H25NO7 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 2-hydroxy-3-[2-[2-[2-[2-hydroxy-3-(hydroxymethyl)phenoxy]ethylamino]ethoxy]ethoxy]benzaldehyde |
| SMILES | O=Cc1cccc(OCCOCCNCCOc2cccc(CO)c2O)c1O |
| InChI | InChI=1S/C20H25NO7/c22-13-15-3-1-5-17(19(15)24)27-10-8-21-7-9-26-11-12-28-18-6-2-4-16(14-23)20(18)25/h1-6,14,21-22,24-25H,7-13H2 |
| InChIKey | SPBPZSBFVGRYHZ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 117.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|