C18H25NO8 — CID 178004235
2-(2,3-diformylphenoxy)-N-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]acetamide (PubChem CID 178004235) has the molecular formula C18H25NO8 and a molecular weight of 383.40 g/mol. Its IUPAC name is 2-(2,3-diformylphenoxy)-N-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]acetamide.
| Compound Name | 2-(2,3-diformylphenoxy)-N-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 178004235 |
| Molecular Formula | C18H25NO8 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 2-(2,3-diformylphenoxy)-N-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]acetamide |
| SMILES | O=Cc1cccc(OCC(=O)NCCOCCOCCOCCO)c1C=O |
| InChI | InChI=1S/C18H25NO8/c20-5-7-25-9-11-26-10-8-24-6-4-19-18(23)14-27-17-3-1-2-15(12-21)16(17)13-22/h1-3,12-13,20H,4-11,14H2,(H,19,23) |
| InChIKey | AYUWOPZUMILCEG-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|