C22H35NO7 — CID 167136638
N-[2-[2-[2-(2-butoxyethoxy)ethoxy]ethoxy]ethyl]-2-(2-formyl-3-methylphenoxy)acetamide (PubChem CID 167136638) has the molecular formula C22H35NO7 and a molecular weight of 425.52 g/mol. Its IUPAC name is N-[2-[2-[2-(2-butoxyethoxy)ethoxy]ethoxy]ethyl]-2-(2-formyl-3-methylphenoxy)acetamide.
| Compound Name | N-[2-[2-[2-(2-butoxyethoxy)ethoxy]ethoxy]ethyl]-2-(2-formyl-3-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 167136638 |
| Molecular Formula | C22H35NO7 |
| Molecular Weight | 425.52 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | N-[2-[2-[2-(2-butoxyethoxy)ethoxy]ethoxy]ethyl]-2-(2-formyl-3-methylphenoxy)acetamide |
| SMILES | CCCCOCCOCCOCCOCCNC(=O)COc1cccc(C)c1C=O |
| InChI | InChI=1S/C22H35NO7/c1-3-4-9-26-11-13-28-15-16-29-14-12-27-10-8-23-22(25)18-30-21-7-5-6-19(2)20(21)17-24/h5-7,17H,3-4,8-16,18H2,1-2H3,(H,23,25) |
| InChIKey | XAQIFSDPDFIKFB-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.52 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|