C21H20N2O2 — CID 163972370
11a-methyl-5,6a,11,12,12a,14a-hexahydro-4aH-quinolino[2,3-b]acridine-7,14-dione (PubChem CID 163972370) has the molecular formula C21H20N2O2 and a molecular weight of 332.40 g/mol. Its IUPAC name is 11a-methyl-5,6a,11,12,12a,14a-hexahydro-4aH-quinolino[2,3-b]acridine-7,14-dione.
| Compound Name | 11a-methyl-5,6a,11,12,12a,14a-hexahydro-4aH-quinolino[2,3-b]acridine-7,14-dione |
|---|---|
| PubChem CID | 163972370 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 11a-methyl-5,6a,11,12,12a,14a-hexahydro-4aH-quinolino[2,3-b]acridine-7,14-dione |
| SMILES | CC12CC=CC=C1C(=O)C1C=C3NC4C=CC=CC4C(=O)C3=CC1N2 |
| InChI | InChI=1S/C21H20N2O2/c1-21-9-5-4-7-15(21)20(25)14-10-17-13(11-18(14)23-21)19(24)12-6-2-3-8-16(12)22-17/h2-8,10-12,14,16,18,22-23H,9H2,1H3 |
| InChIKey | SRCSXWZQJKQBLK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |