C20H20N2O2 — CID 129110583
(2E,3E)-2,3-di(ethylidene)-1,4a,6,6a,10a,12a-hexahydropyrido[2,3-b]acridine-4,11-dione (PubChem CID 129110583) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is (2E,3E)-2,3-di(ethylidene)-1,4a,6,6a,10a,12a-hexahydropyrido[2,3-b]acridine-4,11-dione.
| Compound Name | (2E,3E)-2,3-di(ethylidene)-1,4a,6,6a,10a,12a-hexahydropyrido[2,3-b]acridine-4,11-dione |
|---|---|
| PubChem CID | 129110583 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | (2E,3E)-2,3-di(ethylidene)-1,4a,6,6a,10a,12a-hexahydropyrido[2,3-b]acridine-4,11-dione |
| SMILES | C/C=C1/NC2C=C3C(=O)C4C=CC=CC4NC3=CC2C(=O)/C1=C/C |
| InChI | InChI=1S/C20H20N2O2/c1-3-11-15(4-2)21-17-10-14-18(9-13(17)19(11)23)22-16-8-6-5-7-12(16)20(14)24/h3-10,12-13,16-17,21-22H,1-2H3/b11-3+,15-4+ |
| InChIKey | ZWELWPILHMVLPJ-WLKBOVPDSA-N |
| XLogP | 2.10 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|