C20H34O4S2 — CID 163973483
2-methyl-5-[(2-methylpropan-2-yl)oxy]-4-propyl-8-thiophen-2-ylsulfonyloctan-3-one (PubChem CID 163973483) has the molecular formula C20H34O4S2 and a molecular weight of 402.62 g/mol. Its IUPAC name is 2-methyl-5-[(2-methylpropan-2-yl)oxy]-4-propyl-8-thiophen-2-ylsulfonyloctan-3-one.
| Compound Name | 2-methyl-5-[(2-methylpropan-2-yl)oxy]-4-propyl-8-thiophen-2-ylsulfonyloctan-3-one |
|---|---|
| PubChem CID | 163973483 |
| Molecular Formula | C20H34O4S2 |
| Molecular Weight | 402.62 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 2-methyl-5-[(2-methylpropan-2-yl)oxy]-4-propyl-8-thiophen-2-ylsulfonyloctan-3-one |
| SMILES | CCCC(C(=O)C(C)C)C(CCCS(=O)(=O)c1cccs1)OC(C)(C)C |
| InChI | InChI=1S/C20H34O4S2/c1-7-10-16(19(21)15(2)3)17(24-20(4,5)6)11-9-14-26(22,23)18-12-8-13-25-18/h8,12-13,15-17H,7,9-11,14H2,1-6H3 |
| InChIKey | SSBIDGAAAHITLR-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.62 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |