About tert-butyl 2-thiophen-2-ylsulfonylacetate;tert-butyl 4-thiophen-2-ylsulfonyloxane-4-carboxylate
tert-butyl 2-thiophen-2-ylsulfonylacetate;tert-butyl 4-thiophen-2-ylsulfonyloxane-4-carboxylate (PubChem CID 158181503) has the molecular formula C24H34O9S4
and a molecular weight of 594.80 g/mol. Its IUPAC name is tert-butyl 2-thiophen-2-ylsulfonylacetate;tert-butyl 4-thiophen-2-ylsulfonyloxane-4-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 2-thiophen-2-ylsulfonylacetate;tert-butyl 4-thiophen-2-ylsulfonyloxane-4-carboxylate |
| PubChem CID | 158181503 |
| Molecular Formula | C24H34O9S4 |
| Molecular Weight | 594.80 g/mol |
| Exact Mass | 594.11 |
| IUPAC Name | tert-butyl 2-thiophen-2-ylsulfonylacetate;tert-butyl 4-thiophen-2-ylsulfonyloxane-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(S(=O)(=O)c2cccs2)CCOCC1.CC(C)(C)OC(=O)CS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C14H20O5S2.C10H14O4S2/c1-13(2,3)19-12(15)14(6-8-18-9-7-14)21(16,17)11-5-4-10-20-11;1-10(2,3)14-8(11)7-16(12,13)9-5-4-6-15-9/h4-5,10H,6-9H2,1-3H3;4-6H,7H2,1-3H3 |
| InChIKey | FYQOVHOKEPXTCQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 594.80 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Analyze tert-butyl 2-thiophen-2-ylsulfonylacetate;tert-butyl 4-thiophen-2-ylsulfonyloxane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-thiophen-2-ylsulfonylacetate;tert-butyl 4-thiophen-2-ylsulfonyloxane-4-carboxylate?
The IUPAC name of tert-butyl 2-thiophen-2-ylsulfonylacetate;tert-butyl 4-thiophen-2-ylsulfonyloxane-4-carboxylate (CID 158181503) is tert-butyl 2-thiophen-2-ylsulfonylacetate;tert-butyl 4-thiophen-2-ylsulfonyloxane-4-carboxylate.
What is the SMILES notation for tert-butyl 2-thiophen-2-ylsulfonylacetate;tert-butyl 4-thiophen-2-ylsulfonyloxane-4-carboxylate?
The canonical SMILES for tert-butyl 2-thiophen-2-ylsulfonylacetate;tert-butyl 4-thiophen-2-ylsulfonyloxane-4-carboxylate is CC(C)(C)OC(=O)C1(S(=O)(=O)c2cccs2)CCOCC1.CC(C)(C)OC(=O)CS(=O)(=O)c1cccs1.
What is the InChIKey of tert-butyl 2-thiophen-2-ylsulfonylacetate;tert-butyl 4-thiophen-2-ylsulfonyloxane-4-carboxylate?
The InChIKey is FYQOVHOKEPXTCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O5S2.C10H14O4S2/c1-13(2,3)19-12(15)14(6-8-18-9-7-14)21(16,17)11-5-4-10-20-11;1-10(2,3)14-8(11)7-16(12,13)9-5-4-6-15-9/h4-5,10H,6-9H2,1-3H3;4-6H,7H2,1-3H3.
What are the key properties of tert-butyl 2-thiophen-2-ylsulfonylacetate;tert-butyl 4-thiophen-2-ylsulfonyloxane-4-carboxylate?
tert-butyl 2-thiophen-2-ylsulfonylacetate;tert-butyl 4-thiophen-2-ylsulfonyloxane-4-carboxylate has a molecular weight of 594.80 g/mol, XLogP of 4.28, 6 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-thiophen-2-ylsulfonylacetate;tert-butyl 4-thiophen-2-ylsulfonyloxane-4-carboxylate is sourced from PubChem (CID 158181503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).