C21H36F3NO6S — CID 21069251
tert-butyl 4-[4-[2-(4,4,4-trifluorobutoxy)ethyl]piperidin-1-yl]sulfonyloxane-4-carboxylate (PubChem CID 21069251) has the molecular formula C21H36F3NO6S and a molecular weight of 487.58 g/mol. Its IUPAC name is tert-butyl 4-[4-[2-(4,4,4-trifluorobutoxy)ethyl]piperidin-1-yl]sulfonyloxane-4-carboxylate.
| Compound Name | tert-butyl 4-[4-[2-(4,4,4-trifluorobutoxy)ethyl]piperidin-1-yl]sulfonyloxane-4-carboxylate |
|---|---|
| PubChem CID | 21069251 |
| Molecular Formula | C21H36F3NO6S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | tert-butyl 4-[4-[2-(4,4,4-trifluorobutoxy)ethyl]piperidin-1-yl]sulfonyloxane-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(S(=O)(=O)N2CCC(CCOCCCC(F)(F)F)CC2)CCOCC1 |
| InChI | InChI=1S/C21H36F3NO6S/c1-19(2,3)31-18(26)20(9-15-30-16-10-20)32(27,28)25-11-5-17(6-12-25)7-14-29-13-4-8-21(22,23)24/h17H,4-16H2,1-3H3 |
| InChIKey | WZEMVGBMRSVMLR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|