C19H33F3N2O6S — CID 91513512
N-hydroxy-N-[4-[4-(4,4,4-trifluorobutoxy)butyl]piperidin-1-yl]sulfonyloxane-4-carboxamide (PubChem CID 91513512) has the molecular formula C19H33F3N2O6S and a molecular weight of 474.54 g/mol. Its IUPAC name is N-hydroxy-N-[4-[4-(4,4,4-trifluorobutoxy)butyl]piperidin-1-yl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-N-[4-[4-(4,4,4-trifluorobutoxy)butyl]piperidin-1-yl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 91513512 |
| Molecular Formula | C19H33F3N2O6S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | N-hydroxy-N-[4-[4-(4,4,4-trifluorobutoxy)butyl]piperidin-1-yl]sulfonyloxane-4-carboxamide |
| SMILES | O=C(C1CCOCC1)N(O)S(=O)(=O)N1CCC(CCCCOCCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C19H33F3N2O6S/c20-19(21,22)9-3-13-29-12-2-1-4-16-5-10-23(11-6-16)31(27,28)24(26)18(25)17-7-14-30-15-8-17/h16-17,26H,1-15H2 |
| InChIKey | OUNDBIPPOUTBJL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|