C22H38F3NO6S — CID 21069236
tert-butyl 4-[4-[5-(2,2,2-trifluoroethoxy)pentyl]piperidin-1-yl]sulfonyloxane-4-carboxylate (PubChem CID 21069236) has the molecular formula C22H38F3NO6S and a molecular weight of 501.61 g/mol. Its IUPAC name is tert-butyl 4-[4-[5-(2,2,2-trifluoroethoxy)pentyl]piperidin-1-yl]sulfonyloxane-4-carboxylate.
| Compound Name | tert-butyl 4-[4-[5-(2,2,2-trifluoroethoxy)pentyl]piperidin-1-yl]sulfonyloxane-4-carboxylate |
|---|---|
| PubChem CID | 21069236 |
| Molecular Formula | C22H38F3NO6S |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | tert-butyl 4-[4-[5-(2,2,2-trifluoroethoxy)pentyl]piperidin-1-yl]sulfonyloxane-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(S(=O)(=O)N2CCC(CCCCCOCC(F)(F)F)CC2)CCOCC1 |
| InChI | InChI=1S/C22H38F3NO6S/c1-20(2,3)32-19(27)21(10-15-30-16-11-21)33(28,29)26-12-8-18(9-13-26)7-5-4-6-14-31-17-22(23,24)25/h18H,4-17H2,1-3H3 |
| InChIKey | RHPGQVKYZUSUSL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|