C24H41F3N2O4S — CID 143045234
tert-butyl 4-[methyl-[4-[(E)-8,8,8-trifluorooct-4-enyl]piperidin-1-yl]oxysulfanylamino]oxane-4-carboxylate (PubChem CID 143045234) has the molecular formula C24H41F3N2O4S and a molecular weight of 510.66 g/mol. Its IUPAC name is tert-butyl 4-[methyl-[4-[(E)-8,8,8-trifluorooct-4-enyl]piperidin-1-yl]oxysulfanylamino]oxane-4-carboxylate.
| Compound Name | tert-butyl 4-[methyl-[4-[(E)-8,8,8-trifluorooct-4-enyl]piperidin-1-yl]oxysulfanylamino]oxane-4-carboxylate |
|---|---|
| PubChem CID | 143045234 |
| Molecular Formula | C24H41F3N2O4S |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | tert-butyl 4-[methyl-[4-[(E)-8,8,8-trifluorooct-4-enyl]piperidin-1-yl]oxysulfanylamino]oxane-4-carboxylate |
| SMILES | CN(SON1CCC(CCC/C=C/CCC(F)(F)F)CC1)C1(C(=O)OC(C)(C)C)CCOCC1 |
| InChI | InChI=1S/C24H41F3N2O4S/c1-22(2,3)32-21(30)23(14-18-31-19-15-23)28(4)34-33-29-16-11-20(12-17-29)10-8-6-5-7-9-13-24(25,26)27/h5,7,20H,6,8-19H2,1-4H3/b7-5+ |
| InChIKey | LERXOPXOAXRRAB-FNORWQNLSA-N |
| XLogP | 6.08 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|