C23H37F5N2O4S — CID 143045220
tert-butyl 4-[methyl-[4-[(E)-6,6,7,7,7-pentafluorohept-3-enyl]piperidin-1-yl]oxysulfanylamino]oxane-4-carboxylate (PubChem CID 143045220) has the molecular formula C23H37F5N2O4S and a molecular weight of 532.62 g/mol. Its IUPAC name is tert-butyl 4-[methyl-[4-[(E)-6,6,7,7,7-pentafluorohept-3-enyl]piperidin-1-yl]oxysulfanylamino]oxane-4-carboxylate.
| Compound Name | tert-butyl 4-[methyl-[4-[(E)-6,6,7,7,7-pentafluorohept-3-enyl]piperidin-1-yl]oxysulfanylamino]oxane-4-carboxylate |
|---|---|
| PubChem CID | 143045220 |
| Molecular Formula | C23H37F5N2O4S |
| Molecular Weight | 532.62 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | tert-butyl 4-[methyl-[4-[(E)-6,6,7,7,7-pentafluorohept-3-enyl]piperidin-1-yl]oxysulfanylamino]oxane-4-carboxylate |
| SMILES | CN(SON1CCC(CC/C=C/CC(F)(F)C(F)(F)F)CC1)C1(C(=O)OC(C)(C)C)CCOCC1 |
| InChI | InChI=1S/C23H37F5N2O4S/c1-20(2,3)33-19(31)21(12-16-32-17-13-21)29(4)35-34-30-14-9-18(10-15-30)8-6-5-7-11-22(24,25)23(26,27)28/h5,7,18H,6,8-17H2,1-4H3/b7-5+ |
| InChIKey | RUVZZPSJNRYNQJ-FNORWQNLSA-N |
| XLogP | 5.94 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.62 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|