C19H10ClNO — CID 163976065
(3E)-5-chloro-3-(5,6-didehydroazulen-1-ylmethylidene)-1H-indol-2-one (PubChem CID 163976065) has the molecular formula C19H10ClNO and a molecular weight of 303.75 g/mol. Its IUPAC name is (3E)-5-chloro-3-(5,6-didehydroazulen-1-ylmethylidene)-1H-indol-2-one.
| Compound Name | (3E)-5-chloro-3-(5,6-didehydroazulen-1-ylmethylidene)-1H-indol-2-one |
|---|---|
| PubChem CID | 163976065 |
| Molecular Formula | C19H10ClNO |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | (3E)-5-chloro-3-(5,6-didehydroazulen-1-ylmethylidene)-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(Cl)cc2/C1=C\c1ccc2cc#cccc1-2 |
| InChI | InChI=1S/C19H10ClNO/c20-14-8-9-18-16(11-14)17(19(22)21-18)10-13-7-6-12-4-2-1-3-5-15(12)13/h3-11H,(H,21,22)/b17-10+ |
| InChIKey | SUFXEFOENOZIOO-LICLKQGHSA-N |
| XLogP | 4.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|