C14H25NO — CID 163977699
3-[(2E,4E,6R)-4,6-dimethyldeca-2,4-dien-2-yl]oxiran-2-amine (PubChem CID 163977699) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is 3-[(2E,4E,6R)-4,6-dimethyldeca-2,4-dien-2-yl]oxiran-2-amine.
| Compound Name | 3-[(2E,4E,6R)-4,6-dimethyldeca-2,4-dien-2-yl]oxiran-2-amine |
|---|---|
| PubChem CID | 163977699 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | 3-[(2E,4E,6R)-4,6-dimethyldeca-2,4-dien-2-yl]oxiran-2-amine |
| SMILES | CCCC[C@@H](C)/C=C(C)/C=C(\C)C1OC1N |
| InChI | InChI=1S/C14H25NO/c1-5-6-7-10(2)8-11(3)9-12(4)13-14(15)16-13/h8-10,13-14H,5-7,15H2,1-4H3/b11-8+,12-9+/t10-,13?,14?/m1/s1 |
| InChIKey | SVPVWTKNOYLIPU-GTSFXLIZSA-N |
| XLogP | 3.39 |
| TPSA | 38.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|