C20H20O3 — CID 163982300
(10-methyl-2-tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,10,12,14-heptaenyl) 2-methoxyacetate (PubChem CID 163982300) has the molecular formula C20H20O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is (10-methyl-2-tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,10,12,14-heptaenyl) 2-methoxyacetate.
| Compound Name | (10-methyl-2-tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,10,12,14-heptaenyl) 2-methoxyacetate |
|---|---|
| PubChem CID | 163982300 |
| Molecular Formula | C20H20O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | (10-methyl-2-tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,10,12,14-heptaenyl) 2-methoxyacetate |
| SMILES | COCC(=O)OC1Cc2ccccc2C(C)=Cc2ccccc21 |
| InChI | InChI=1S/C20H20O3/c1-14-11-15-7-4-6-10-18(15)19(23-20(21)13-22-2)12-16-8-3-5-9-17(14)16/h3-11,19H,12-13H2,1-2H3 |
| InChIKey | SZMGFOIOOQSPMZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|