C20H31NO — CID 163982744
cyclohex-2-en-1-yl-[1-methyl-3-[(3Z,5Z)-2-methylhepta-3,5-dienyl]pyrrolidin-2-yl]methanone (PubChem CID 163982744) has the molecular formula C20H31NO and a molecular weight of 301.47 g/mol. Its IUPAC name is cyclohex-2-en-1-yl-[1-methyl-3-[(3Z,5Z)-2-methylhepta-3,5-dienyl]pyrrolidin-2-yl]methanone.
| Compound Name | cyclohex-2-en-1-yl-[1-methyl-3-[(3Z,5Z)-2-methylhepta-3,5-dienyl]pyrrolidin-2-yl]methanone |
|---|---|
| PubChem CID | 163982744 |
| Molecular Formula | C20H31NO |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | cyclohex-2-en-1-yl-[1-methyl-3-[(3Z,5Z)-2-methylhepta-3,5-dienyl]pyrrolidin-2-yl]methanone |
| SMILES | C/C=C\C=C/C(C)CC1CCN(C)C1C(=O)C1C=CCCC1 |
| InChI | InChI=1S/C20H31NO/c1-4-5-7-10-16(2)15-18-13-14-21(3)19(18)20(22)17-11-8-6-9-12-17/h4-5,7-8,10-11,16-19H,6,9,12-15H2,1-3H3/b5-4-,10-7- |
| InChIKey | SZVGXMLSCIESAM-WKBXPBOGSA-N |
| XLogP | 4.39 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|