About (N-amino-N'-butyl-N-methylcarbamimidoyl)azanide
(N-amino-N'-butyl-N-methylcarbamimidoyl)azanide (PubChem CID 163987126) has the molecular formula C6H15N4-
and a molecular weight of 143.21 g/mol. Its IUPAC name is (N-amino-N'-butyl-N-methylcarbamimidoyl)azanide.
Molecular Properties
| Compound Name | (N-amino-N'-butyl-N-methylcarbamimidoyl)azanide |
| PubChem CID | 163987126 |
| Molecular Formula | C6H15N4- |
| Molecular Weight | 143.21 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | (N-amino-N'-butyl-N-methylcarbamimidoyl)azanide |
| SMILES | CCCC/N=C(\[NH-])N(C)N |
| InChI | InChI=1S/C6H15N4/c1-3-4-5-9-6(7)10(2)8/h3-5,8H2,1-2H3,(H-,7,9)/q-1 |
| InChIKey | CWLODMROAJCVGP-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 65.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.21 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (N-amino-N'-butyl-N-methylcarbamimidoyl)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (N-amino-N'-butyl-N-methylcarbamimidoyl)azanide?
The IUPAC name of (N-amino-N'-butyl-N-methylcarbamimidoyl)azanide (CID 163987126) is (N-amino-N'-butyl-N-methylcarbamimidoyl)azanide.
What is the SMILES notation for (N-amino-N'-butyl-N-methylcarbamimidoyl)azanide?
The canonical SMILES for (N-amino-N'-butyl-N-methylcarbamimidoyl)azanide is CCCC/N=C(\[NH-])N(C)N.
What is the InChIKey of (N-amino-N'-butyl-N-methylcarbamimidoyl)azanide?
The InChIKey is CWLODMROAJCVGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N4/c1-3-4-5-9-6(7)10(2)8/h3-5,8H2,1-2H3,(H-,7,9)/q-1.
What are the key properties of (N-amino-N'-butyl-N-methylcarbamimidoyl)azanide?
(N-amino-N'-butyl-N-methylcarbamimidoyl)azanide has a molecular weight of 143.21 g/mol, XLogP of 1.00, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (N-amino-N'-butyl-N-methylcarbamimidoyl)azanide is sourced from PubChem (CID 163987126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).