C13H23F3S — CID 163995584
(E)-3,6-dimethyl-2-propan-2-ylsulfanyl-4-(trifluoromethyl)hept-3-ene (PubChem CID 163995584) has the molecular formula C13H23F3S and a molecular weight of 268.39 g/mol. Its IUPAC name is (E)-3,6-dimethyl-2-propan-2-ylsulfanyl-4-(trifluoromethyl)hept-3-ene.
| Compound Name | (E)-3,6-dimethyl-2-propan-2-ylsulfanyl-4-(trifluoromethyl)hept-3-ene |
|---|---|
| PubChem CID | 163995584 |
| Molecular Formula | C13H23F3S |
| Molecular Weight | 268.39 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | (E)-3,6-dimethyl-2-propan-2-ylsulfanyl-4-(trifluoromethyl)hept-3-ene |
| SMILES | C/C(=C(/CC(C)C)C(F)(F)F)C(C)SC(C)C |
| InChI | InChI=1S/C13H23F3S/c1-8(2)7-12(13(14,15)16)10(5)11(6)17-9(3)4/h8-9,11H,7H2,1-6H3/b12-10+ |
| InChIKey | UEJSXMSLGGVOFR-ZRDIBKRKSA-N |
| XLogP | 5.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.39 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|