C26H46O4 — CID 163996476
2,4-dimethyl-1-[[5-(oxan-2-yloxy)-3-tricyclo[4.3.1.13,8]undecanyl]oxy]-2-propan-2-ylpentan-1-ol (PubChem CID 163996476) has the molecular formula C26H46O4 and a molecular weight of 422.65 g/mol. Its IUPAC name is 2,4-dimethyl-1-[[5-(oxan-2-yloxy)-3-tricyclo[4.3.1.13,8]undecanyl]oxy]-2-propan-2-ylpentan-1-ol.
| Compound Name | 2,4-dimethyl-1-[[5-(oxan-2-yloxy)-3-tricyclo[4.3.1.13,8]undecanyl]oxy]-2-propan-2-ylpentan-1-ol |
|---|---|
| PubChem CID | 163996476 |
| Molecular Formula | C26H46O4 |
| Molecular Weight | 422.65 g/mol |
| Exact Mass | 422.34 |
| IUPAC Name | 2,4-dimethyl-1-[[5-(oxan-2-yloxy)-3-tricyclo[4.3.1.13,8]undecanyl]oxy]-2-propan-2-ylpentan-1-ol |
| SMILES | CC(C)CC(C)(C(C)C)C(O)OC12CC3CC(CC(C3)C(OC3CCCCO3)C1)C2 |
| InChI | InChI=1S/C26H46O4/c1-17(2)13-25(5,18(3)4)24(27)30-26-14-19-10-20(15-26)12-21(11-19)22(16-26)29-23-8-6-7-9-28-23/h17-24,27H,6-16H2,1-5H3 |
| InChIKey | UFCWMEHDUKMMEW-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.65 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|