C16H23NO2 — CID 175717671
(1S,3R)-5-(oxan-2-yloxy)adamantane-2-carbonitrile (PubChem CID 175717671) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is (1S,3R)-5-(oxan-2-yloxy)adamantane-2-carbonitrile.
| Compound Name | (1S,3R)-5-(oxan-2-yloxy)adamantane-2-carbonitrile |
|---|---|
| PubChem CID | 175717671 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (1S,3R)-5-(oxan-2-yloxy)adamantane-2-carbonitrile |
| SMILES | N#CC1[C@@H]2CC3C[C@H]1CC(OC1CCCCO1)(C3)C2 |
| InChI | InChI=1S/C16H23NO2/c17-10-14-12-5-11-6-13(14)9-16(7-11,8-12)19-15-3-1-2-4-18-15/h11-15H,1-9H2/t11?,12-,13+,14?,15?,16? |
| InChIKey | OCMFSVNLBUWPOD-JGCJJIHASA-N |
| XLogP | 3.25 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |