C13H25N3 — CID 163997811
4-tert-butyl-5,7,10-triazatricyclo[6.4.0.02,6]dodecane (PubChem CID 163997811) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is 4-tert-butyl-5,7,10-triazatricyclo[6.4.0.02,6]dodecane.
| Compound Name | 4-tert-butyl-5,7,10-triazatricyclo[6.4.0.02,6]dodecane |
|---|---|
| PubChem CID | 163997811 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | 4-tert-butyl-5,7,10-triazatricyclo[6.4.0.02,6]dodecane |
| SMILES | CC(C)(C)C1CC2C(NC3CNCCC32)N1 |
| InChI | InChI=1S/C13H25N3/c1-13(2,3)11-6-9-8-4-5-14-7-10(8)15-12(9)16-11/h8-12,14-16H,4-7H2,1-3H3 |
| InChIKey | UGGIXIMLHQUVAN-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |