C10H19N3 — CID 163551095
4-methyl-5,7,10-triazatricyclo[6.4.0.02,6]dodecane (PubChem CID 163551095) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is 4-methyl-5,7,10-triazatricyclo[6.4.0.02,6]dodecane.
| Compound Name | 4-methyl-5,7,10-triazatricyclo[6.4.0.02,6]dodecane |
|---|---|
| PubChem CID | 163551095 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 4-methyl-5,7,10-triazatricyclo[6.4.0.02,6]dodecane |
| SMILES | CC1CC2C(N1)NC1CNCCC12 |
| InChI | InChI=1S/C10H19N3/c1-6-4-8-7-2-3-11-5-9(7)13-10(8)12-6/h6-13H,2-5H2,1H3 |
| InChIKey | FJDIBEHEXHMGAX-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |