C15H29N — CID 161153492
(3aS,5S,6aS)-2,5-ditert-butyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole (PubChem CID 161153492) has the molecular formula C15H29N and a molecular weight of 223.40 g/mol. Its IUPAC name is (3aS,5S,6aS)-2,5-ditert-butyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole.
| Compound Name | (3aS,5S,6aS)-2,5-ditert-butyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole |
|---|---|
| PubChem CID | 161153492 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | (3aS,5S,6aS)-2,5-ditert-butyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole |
| SMILES | CC(C)(C)C1C[C@@H]2C[C@H](C(C)(C)C)C[C@@H]2N1 |
| InChI | InChI=1S/C15H29N/c1-14(2,3)11-7-10-8-13(15(4,5)6)16-12(10)9-11/h10-13,16H,7-9H2,1-6H3/t10-,11-,12-,13?/m0/s1 |
| InChIKey | UOZMXPITDKXOSO-TXRDPFJMSA-N |
| XLogP | 3.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |