C12H22N2 — CID 163998141
N-ethyl-N-pentyl-3,4-dihydropyridin-2-amine (PubChem CID 163998141) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is N-ethyl-N-pentyl-3,4-dihydropyridin-2-amine.
| Compound Name | N-ethyl-N-pentyl-3,4-dihydropyridin-2-amine |
|---|---|
| PubChem CID | 163998141 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | N-ethyl-N-pentyl-3,4-dihydropyridin-2-amine |
| SMILES | CCCCCN(CC)C1=NC=CCC1 |
| InChI | InChI=1S/C12H22N2/c1-3-5-8-11-14(4-2)12-9-6-7-10-13-12/h7,10H,3-6,8-9,11H2,1-2H3 |
| InChIKey | UGNSWNMEKWYWNF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|