C21H23N5O — CID 163999010
2-N-(5-amino-2-methoxy-4-methylphenyl)-4-N-(2-ethanimidoylphenyl)pyridine-2,4-diamine (PubChem CID 163999010) has the molecular formula C21H23N5O and a molecular weight of 361.45 g/mol. Its IUPAC name is 2-N-(5-amino-2-methoxy-4-methylphenyl)-4-N-(2-ethanimidoylphenyl)pyridine-2,4-diamine.
| Compound Name | 2-N-(5-amino-2-methoxy-4-methylphenyl)-4-N-(2-ethanimidoylphenyl)pyridine-2,4-diamine |
|---|---|
| PubChem CID | 163999010 |
| Molecular Formula | C21H23N5O |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 2-N-(5-amino-2-methoxy-4-methylphenyl)-4-N-(2-ethanimidoylphenyl)pyridine-2,4-diamine |
| SMILES | [H]/N=C(\C)c1ccccc1Nc1ccnc(Nc2cc(N)c(C)cc2OC)c1 |
| InChI | InChI=1S/C21H23N5O/c1-13-10-20(27-3)19(12-17(13)23)26-21-11-15(8-9-24-21)25-18-7-5-4-6-16(18)14(2)22/h4-12,22H,23H2,1-3H3,(H2,24,25,26)/b22-14+ |
| InChIKey | UHGZRASZQKYPMX-HYARGMPZSA-N |
| XLogP | 4.86 |
| TPSA | 96.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|