C20H37BO2 — CID 164510841
methane;4,4,5,5-tetramethyl-2-[3-[(E)-oct-1-enyl]-1-bicyclo[1.1.1]pentanyl]-1,3,2-dioxaborolane (PubChem CID 164510841) has the molecular formula C20H37BO2 and a molecular weight of 320.33 g/mol. Its IUPAC name is methane;4,4,5,5-tetramethyl-2-[3-[(E)-oct-1-enyl]-1-bicyclo[1.1.1]pentanyl]-1,3,2-dioxaborolane.
| Compound Name | methane;4,4,5,5-tetramethyl-2-[3-[(E)-oct-1-enyl]-1-bicyclo[1.1.1]pentanyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 164510841 |
| Molecular Formula | C20H37BO2 |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.29 |
| IUPAC Name | methane;4,4,5,5-tetramethyl-2-[3-[(E)-oct-1-enyl]-1-bicyclo[1.1.1]pentanyl]-1,3,2-dioxaborolane |
| SMILES | C.CCCCCC/C=C/C12CC(B3OC(C)(C)C(C)(C)O3)(C1)C2 |
| InChI | InChI=1S/C19H33BO2.CH4/c1-6-7-8-9-10-11-12-18-13-19(14-18,15-18)20-21-16(2,3)17(4,5)22-20;/h11-12H,6-10,13-15H2,1-5H3;1H4/b12-11+; |
| InChIKey | CQHALXRXEJEXII-CALJPSDSSA-N |
| XLogP | 6.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|