C20H31BO2 — CID 91036906
4,4,5,5-tetramethyl-2-[4-(1-propylcyclobutyl)cyclohepta-1,3,5-trien-1-yl]-1,3,2-dioxaborolane (PubChem CID 91036906) has the molecular formula C20H31BO2 and a molecular weight of 314.28 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[4-(1-propylcyclobutyl)cyclohepta-1,3,5-trien-1-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[4-(1-propylcyclobutyl)cyclohepta-1,3,5-trien-1-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 91036906 |
| Molecular Formula | C20H31BO2 |
| Molecular Weight | 314.28 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[4-(1-propylcyclobutyl)cyclohepta-1,3,5-trien-1-yl]-1,3,2-dioxaborolane |
| SMILES | CCCC1(C2=CC=C(B3OC(C)(C)C(C)(C)O3)CC=C2)CCC1 |
| InChI | InChI=1S/C20H31BO2/c1-6-13-20(14-8-15-20)16-9-7-10-17(12-11-16)21-22-18(2,3)19(4,5)23-21/h7,9,11-12H,6,8,10,13-15H2,1-5H3 |
| InChIKey | IALUSABPXHHCGR-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.28 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|