C17H27BO2 — CID 176660031
2-[2-[(2Z)-2-ethenylpenta-2,4-dienyl]-3-methylcyclopropyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 176660031) has the molecular formula C17H27BO2 and a molecular weight of 274.21 g/mol. Its IUPAC name is 2-[2-[(2Z)-2-ethenylpenta-2,4-dienyl]-3-methylcyclopropyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[2-[(2Z)-2-ethenylpenta-2,4-dienyl]-3-methylcyclopropyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 176660031 |
| Molecular Formula | C17H27BO2 |
| Molecular Weight | 274.21 g/mol |
| Exact Mass | 274.21 |
| IUPAC Name | 2-[2-[(2Z)-2-ethenylpenta-2,4-dienyl]-3-methylcyclopropyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=C/C=C(\C=C)CC1C(C)C1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H27BO2/c1-8-10-13(9-2)11-14-12(3)15(14)18-19-16(4,5)17(6,7)20-18/h8-10,12,14-15H,1-2,11H2,3-7H3/b13-10+ |
| InChIKey | NODHWFSKXMZCAJ-JLHYYAGUSA-N |
| XLogP | 4.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.21 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|