C19H29BO2 — CID 144953354
2-[1-(6-tert-butyl-3-bicyclo[4.1.0]hepta-2,4-dienyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 144953354) has the molecular formula C19H29BO2 and a molecular weight of 300.25 g/mol. Its IUPAC name is 2-[1-(6-tert-butyl-3-bicyclo[4.1.0]hepta-2,4-dienyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[1-(6-tert-butyl-3-bicyclo[4.1.0]hepta-2,4-dienyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 144953354 |
| Molecular Formula | C19H29BO2 |
| Molecular Weight | 300.25 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | 2-[1-(6-tert-butyl-3-bicyclo[4.1.0]hepta-2,4-dienyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=C(B1OC(C)(C)C(C)(C)O1)C1=CC2CC2(C(C)(C)C)C=C1 |
| InChI | InChI=1S/C19H29BO2/c1-13(20-21-17(5,6)18(7,8)22-20)14-9-10-19(16(2,3)4)12-15(19)11-14/h9-11,15H,1,12H2,2-8H3 |
| InChIKey | OTKVXJOPYFAVBY-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.25 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|