C32H24N2O — CID 164511196
7-methyl-2-(7-methylquinolin-8-yl)-3,4-diphenylisoquinolin-1-one (PubChem CID 164511196) has the molecular formula C32H24N2O and a molecular weight of 452.56 g/mol. Its IUPAC name is 7-methyl-2-(7-methylquinolin-8-yl)-3,4-diphenylisoquinolin-1-one.
| Compound Name | 7-methyl-2-(7-methylquinolin-8-yl)-3,4-diphenylisoquinolin-1-one |
|---|---|
| PubChem CID | 164511196 |
| Molecular Formula | C32H24N2O |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 7-methyl-2-(7-methylquinolin-8-yl)-3,4-diphenylisoquinolin-1-one |
| SMILES | Cc1ccc2c(-c3ccccc3)c(-c3ccccc3)n(-c3c(C)ccc4cccnc34)c(=O)c2c1 |
| InChI | InChI=1S/C32H24N2O/c1-21-15-18-26-27(20-21)32(35)34(30-22(2)16-17-24-14-9-19-33-29(24)30)31(25-12-7-4-8-13-25)28(26)23-10-5-3-6-11-23/h3-20H,1-2H3 |
| InChIKey | SZXYLEKSORCOKQ-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |