C31H22N2O2 — CID 164511227
2-(7-methyl-1-oxidoquinolin-1-ium-8-yl)-3,4-diphenylisoquinolin-1-one (PubChem CID 164511227) has the molecular formula C31H22N2O2 and a molecular weight of 454.53 g/mol. Its IUPAC name is 2-(7-methyl-1-oxidoquinolin-1-ium-8-yl)-3,4-diphenylisoquinolin-1-one.
| Compound Name | 2-(7-methyl-1-oxidoquinolin-1-ium-8-yl)-3,4-diphenylisoquinolin-1-one |
|---|---|
| PubChem CID | 164511227 |
| Molecular Formula | C31H22N2O2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 2-(7-methyl-1-oxidoquinolin-1-ium-8-yl)-3,4-diphenylisoquinolin-1-one |
| SMILES | Cc1ccc2ccc[n+]([O-])c2c1-n1c(-c2ccccc2)c(-c2ccccc2)c2ccccc2c1=O |
| InChI | InChI=1S/C31H22N2O2/c1-21-18-19-24-15-10-20-32(35)30(24)28(21)33-29(23-13-6-3-7-14-23)27(22-11-4-2-5-12-22)25-16-8-9-17-26(25)31(33)34/h2-20H,1H3 |
| InChIKey | CCXWOYBALIGCFD-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 48.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|