C15H13F3O2 — CID 164513778
(2R)-2-(2-methylprop-2-enyl)-4-[4-(trifluoromethyl)phenyl]-2H-furan-5-one (PubChem CID 164513778) has the molecular formula C15H13F3O2 and a molecular weight of 282.26 g/mol. Its IUPAC name is (2R)-2-(2-methylprop-2-enyl)-4-[4-(trifluoromethyl)phenyl]-2H-furan-5-one.
| Compound Name | (2R)-2-(2-methylprop-2-enyl)-4-[4-(trifluoromethyl)phenyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 164513778 |
| Molecular Formula | C15H13F3O2 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | (2R)-2-(2-methylprop-2-enyl)-4-[4-(trifluoromethyl)phenyl]-2H-furan-5-one |
| SMILES | C=C(C)C[C@@H]1C=C(c2ccc(C(F)(F)F)cc2)C(=O)O1 |
| InChI | InChI=1S/C15H13F3O2/c1-9(2)7-12-8-13(14(19)20-12)10-3-5-11(6-4-10)15(16,17)18/h3-6,8,12H,1,7H2,2H3/t12-/m1/s1 |
| InChIKey | IIIXYTBQQCFTRA-GFCCVEGCSA-N |
| XLogP | 3.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|