C12H14F2N2O3 — CID 164522517
ethyl 2-(2,6-difluorophenyl)-5-hydroxypyrazolidine-3-carboxylate (PubChem CID 164522517) has the molecular formula C12H14F2N2O3 and a molecular weight of 272.25 g/mol. Its IUPAC name is ethyl 2-(2,6-difluorophenyl)-5-hydroxypyrazolidine-3-carboxylate.
| Compound Name | ethyl 2-(2,6-difluorophenyl)-5-hydroxypyrazolidine-3-carboxylate |
|---|---|
| PubChem CID | 164522517 |
| Molecular Formula | C12H14F2N2O3 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | ethyl 2-(2,6-difluorophenyl)-5-hydroxypyrazolidine-3-carboxylate |
| SMILES | CCOC(=O)C1CC(O)NN1c1c(F)cccc1F |
| InChI | InChI=1S/C12H14F2N2O3/c1-2-19-12(18)9-6-10(17)15-16(9)11-7(13)4-3-5-8(11)14/h3-5,9-10,15,17H,2,6H2,1H3 |
| InChIKey | BMCSBCSGVIRQCH-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |