C20H19ClN2S — CID 164525842
2-[2-(4-butyl-2-ethylphenyl)ethynyl]-3-chloro-5-isothiocyanatopyridine (PubChem CID 164525842) has the molecular formula C20H19ClN2S and a molecular weight of 354.91 g/mol. Its IUPAC name is 2-[2-(4-butyl-2-ethylphenyl)ethynyl]-3-chloro-5-isothiocyanatopyridine.
| Compound Name | 2-[2-(4-butyl-2-ethylphenyl)ethynyl]-3-chloro-5-isothiocyanatopyridine |
|---|---|
| PubChem CID | 164525842 |
| Molecular Formula | C20H19ClN2S |
| Molecular Weight | 354.91 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 2-[2-(4-butyl-2-ethylphenyl)ethynyl]-3-chloro-5-isothiocyanatopyridine |
| SMILES | CCCCc1ccc(C#Cc2ncc(N=C=S)cc2Cl)c(CC)c1 |
| InChI | InChI=1S/C20H19ClN2S/c1-3-5-6-15-7-8-17(16(4-2)11-15)9-10-20-19(21)12-18(13-22-20)23-14-24/h7-8,11-13H,3-6H2,1-2H3 |
| InChIKey | ICXRSQMGKBVLNC-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.91 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|